C20H29N3O3 — CID 128627769
(3aS,6aS)-N-[4-(2-methoxyethyl)-2-pyridinyl]spiro[2,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrole-3,4'-oxane]-1-carboxamide (PubChem CID 128627769) has the molecular formula C20H29N3O3 and a molecular weight of 359.47 g/mol. Its IUPAC name is (3aS,6aS)-N-[4-(2-methoxyethyl)-2-pyridinyl]spiro[2,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrole-3,4'-oxane]-1-carboxamide.
| Compound Name | (3aS,6aS)-N-[4-(2-methoxyethyl)-2-pyridinyl]spiro[2,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrole-3,4'-oxane]-1-carboxamide |
|---|---|
| PubChem CID | 128627769 |
| Molecular Formula | C20H29N3O3 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | (3aS,6aS)-N-[4-(2-methoxyethyl)-2-pyridinyl]spiro[2,3a,4,5,6,6a-hexahydrocyclopenta[b]pyrrole-3,4'-oxane]-1-carboxamide |
| SMILES | COCCc1ccnc(NC(=O)N2CC3(CCOCC3)[C@@H]3CCC[C@@H]32)c1 |
| InChI | InChI=1S/C20H29N3O3/c1-25-10-6-15-5-9-21-18(13-15)22-19(24)23-14-20(7-11-26-12-8-20)16-3-2-4-17(16)23/h5,9,13,16-17H,2-4,6-8,10-12,14H2,1H3,(H,21,22,24)/t16-,17+/m1/s1 |
| InChIKey | JLWRFDPUAHNJMP-SJORKVTESA-N |
| XLogP | 3.08 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |