C13H17F3N4O2S — CID 128635307
(4aS,7aR)-4-methyl-N-[2,2,2-trifluoro-1-(1,3-thiazol-2-yl)ethyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-6-carboxamide (PubChem CID 128635307) has the molecular formula C13H17F3N4O2S and a molecular weight of 350.37 g/mol. Its IUPAC name is (4aS,7aR)-4-methyl-N-[2,2,2-trifluoro-1-(1,3-thiazol-2-yl)ethyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-6-carboxamide.
| Compound Name | (4aS,7aR)-4-methyl-N-[2,2,2-trifluoro-1-(1,3-thiazol-2-yl)ethyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-6-carboxamide |
|---|---|
| PubChem CID | 128635307 |
| Molecular Formula | C13H17F3N4O2S |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | (4aS,7aR)-4-methyl-N-[2,2,2-trifluoro-1-(1,3-thiazol-2-yl)ethyl]-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazine-6-carboxamide |
| SMILES | CN1CCO[C@@H]2CN(C(=O)NC(c3nccs3)C(F)(F)F)C[C@@H]21 |
| InChI | InChI=1S/C13H17F3N4O2S/c1-19-3-4-22-9-7-20(6-8(9)19)12(21)18-10(13(14,15)16)11-17-2-5-23-11/h2,5,8-10H,3-4,6-7H2,1H3,(H,18,21)/t8-,9+,10?/m0/s1 |
| InChIKey | FAMWKOPZIHPLFE-QIIDTADFSA-N |
| XLogP | 1.47 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |