About 1-methyl-2,3-dihydropyrrole-5-thiol
1-methyl-2,3-dihydropyrrole-5-thiol (PubChem CID 12863627) has the molecular formula C5H9NS
and a molecular weight of 115.20 g/mol. Its IUPAC name is 1-methyl-2,3-dihydropyrrole-5-thiol.
Molecular Properties
| Compound Name | 1-methyl-2,3-dihydropyrrole-5-thiol |
| PubChem CID | 12863627 |
| Molecular Formula | C5H9NS |
| Molecular Weight | 115.20 g/mol |
| Exact Mass | 115.05 |
| IUPAC Name | 1-methyl-2,3-dihydropyrrole-5-thiol |
| SMILES | CN1CCC=C1S |
| InChI | InChI=1S/C5H9NS/c1-6-4-2-3-5(6)7/h3,7H,2,4H2,1H3 |
| InChIKey | DCHKJXDISOGKIC-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.20 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2,3-dihydropyrrole-5-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2,3-dihydropyrrole-5-thiol?
The IUPAC name of 1-methyl-2,3-dihydropyrrole-5-thiol (CID 12863627) is 1-methyl-2,3-dihydropyrrole-5-thiol.
What is the SMILES notation for 1-methyl-2,3-dihydropyrrole-5-thiol?
The canonical SMILES for 1-methyl-2,3-dihydropyrrole-5-thiol is CN1CCC=C1S.
What is the InChIKey of 1-methyl-2,3-dihydropyrrole-5-thiol?
The InChIKey is DCHKJXDISOGKIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NS/c1-6-4-2-3-5(6)7/h3,7H,2,4H2,1H3.
What are the key properties of 1-methyl-2,3-dihydropyrrole-5-thiol?
1-methyl-2,3-dihydropyrrole-5-thiol has a molecular weight of 115.20 g/mol, XLogP of 1.09, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2,3-dihydropyrrole-5-thiol is sourced from PubChem (CID 12863627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).