C17H26N4O2 — CID 128636279
1-(cyclohexanecarbonyl)-N-(3-ethyl-1-methylpyrazol-5-yl)azetidine-3-carboxamide (PubChem CID 128636279) has the molecular formula C17H26N4O2 and a molecular weight of 318.42 g/mol. Its IUPAC name is 1-(cyclohexanecarbonyl)-N-(3-ethyl-1-methylpyrazol-5-yl)azetidine-3-carboxamide.
| Compound Name | 1-(cyclohexanecarbonyl)-N-(3-ethyl-1-methylpyrazol-5-yl)azetidine-3-carboxamide |
|---|---|
| PubChem CID | 128636279 |
| Molecular Formula | C17H26N4O2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | 1-(cyclohexanecarbonyl)-N-(3-ethyl-1-methylpyrazol-5-yl)azetidine-3-carboxamide |
| SMILES | CCc1cc(NC(=O)C2CN(C(=O)C3CCCCC3)C2)n(C)n1 |
| InChI | InChI=1S/C17H26N4O2/c1-3-14-9-15(20(2)19-14)18-16(22)13-10-21(11-13)17(23)12-7-5-4-6-8-12/h9,12-13H,3-8,10-11H2,1-2H3,(H,18,22) |
| InChIKey | GEFOENYBAKXDAS-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |