C8H11Br — CID 12863776
6-bromo-1,2,3,3a,4,5-hexahydropentalene (PubChem CID 12863776) has the molecular formula C8H11Br and a molecular weight of 187.08 g/mol. Its IUPAC name is 6-bromo-1,2,3,3a,4,5-hexahydropentalene.
| Compound Name | 6-bromo-1,2,3,3a,4,5-hexahydropentalene |
|---|---|
| PubChem CID | 12863776 |
| Molecular Formula | C8H11Br |
| Molecular Weight | 187.08 g/mol |
| Exact Mass | 186.00 |
| IUPAC Name | 6-bromo-1,2,3,3a,4,5-hexahydropentalene |
| SMILES | BrC1=C2CCCC2CC1 |
| InChI | InChI=1S/C8H11Br/c9-8-5-4-6-2-1-3-7(6)8/h6H,1-5H2 |
| InChIKey | FNCMNVJZDPKOOJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.08 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |