About methanidyl(trimethyl)silane;trichlorotitanium(1+)
methanidyl(trimethyl)silane;trichlorotitanium(1+) (PubChem CID 12863850) has the molecular formula C4H11Cl3SiTi
and a molecular weight of 241.44 g/mol. Its IUPAC name is methanidyl(trimethyl)silane;trichlorotitanium(1+).
Molecular Properties
| Compound Name | methanidyl(trimethyl)silane;trichlorotitanium(1+) |
| PubChem CID | 12863850 |
| Molecular Formula | C4H11Cl3SiTi |
| Molecular Weight | 241.44 g/mol |
| Exact Mass | 239.92 |
| IUPAC Name | methanidyl(trimethyl)silane;trichlorotitanium(1+) |
| SMILES | Cl[Ti+](Cl)Cl.[CH2-][Si](C)(C)C |
| InChI | InChI=1S/C4H11Si.3ClH.Ti/c1-5(2,3)4;;;;/h1H2,2-4H3;3*1H;/q-1;;;;+4/p-3 |
| InChIKey | HEYLOQGFJAUFRY-UHFFFAOYSA-K |
| XLogP | 3.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.44 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methanidyl(trimethyl)silane;trichlorotitanium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanidyl(trimethyl)silane;trichlorotitanium(1+)?
The IUPAC name of methanidyl(trimethyl)silane;trichlorotitanium(1+) (CID 12863850) is methanidyl(trimethyl)silane;trichlorotitanium(1+).
What is the SMILES notation for methanidyl(trimethyl)silane;trichlorotitanium(1+)?
The canonical SMILES for methanidyl(trimethyl)silane;trichlorotitanium(1+) is Cl[Ti+](Cl)Cl.[CH2-][Si](C)(C)C.
What is the InChIKey of methanidyl(trimethyl)silane;trichlorotitanium(1+)?
The InChIKey is HEYLOQGFJAUFRY-UHFFFAOYSA-K. The full InChI is InChI=1S/C4H11Si.3ClH.Ti/c1-5(2,3)4;;;;/h1H2,2-4H3;3*1H;/q-1;;;;+4/p-3.
What are the key properties of methanidyl(trimethyl)silane;trichlorotitanium(1+)?
methanidyl(trimethyl)silane;trichlorotitanium(1+) has a molecular weight of 241.44 g/mol, XLogP of 3.76, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methanidyl(trimethyl)silane;trichlorotitanium(1+) is sourced from PubChem (CID 12863850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).