C10H8F6N2 — CID 12864055
2,4-bis(trifluoromethyl)-5,6,7,8-tetrahydroquinazoline (PubChem CID 12864055) has the molecular formula C10H8F6N2 and a molecular weight of 270.18 g/mol. Its IUPAC name is 2,4-bis(trifluoromethyl)-5,6,7,8-tetrahydroquinazoline.
| Compound Name | 2,4-bis(trifluoromethyl)-5,6,7,8-tetrahydroquinazoline |
|---|---|
| PubChem CID | 12864055 |
| Molecular Formula | C10H8F6N2 |
| Molecular Weight | 270.18 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | 2,4-bis(trifluoromethyl)-5,6,7,8-tetrahydroquinazoline |
| SMILES | FC(F)(F)c1nc2c(c(C(F)(F)F)n1)CCCC2 |
| InChI | InChI=1S/C10H8F6N2/c11-9(12,13)7-5-3-1-2-4-6(5)17-8(18-7)10(14,15)16/h1-4H2 |
| InChIKey | CJBGZGODPTUJMK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.18 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |