C18H26N6O2S — CID 128641736
2-(4-tert-butyl-1,3-thiazol-2-yl)-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)morpholine-4-carboxamide (PubChem CID 128641736) has the molecular formula C18H26N6O2S and a molecular weight of 390.51 g/mol. Its IUPAC name is 2-(4-tert-butyl-1,3-thiazol-2-yl)-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)morpholine-4-carboxamide.
| Compound Name | 2-(4-tert-butyl-1,3-thiazol-2-yl)-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)morpholine-4-carboxamide |
|---|---|
| PubChem CID | 128641736 |
| Molecular Formula | C18H26N6O2S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 2-(4-tert-butyl-1,3-thiazol-2-yl)-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)morpholine-4-carboxamide |
| SMILES | CC(C)(C)c1csc(C2CN(C(=O)Nc3nc4n(n3)CCCC4)CCO2)n1 |
| InChI | InChI=1S/C18H26N6O2S/c1-18(2,3)13-11-27-15(19-13)12-10-23(8-9-26-12)17(25)21-16-20-14-6-4-5-7-24(14)22-16/h11-12H,4-10H2,1-3H3,(H,21,22,25) |
| InChIKey | XHVFXKMAGKCFEN-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |