C14H23N5O2 — CID 128642390
1-[(1-hydroxycyclohexyl)methyl]-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)urea (PubChem CID 128642390) has the molecular formula C14H23N5O2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 1-[(1-hydroxycyclohexyl)methyl]-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)urea.
| Compound Name | 1-[(1-hydroxycyclohexyl)methyl]-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)urea |
|---|---|
| PubChem CID | 128642390 |
| Molecular Formula | C14H23N5O2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | 1-[(1-hydroxycyclohexyl)methyl]-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)urea |
| SMILES | O=C(NCC1(O)CCCCC1)Nc1nc2n(n1)CCCC2 |
| InChI | InChI=1S/C14H23N5O2/c20-13(15-10-14(21)7-3-1-4-8-14)17-12-16-11-6-2-5-9-19(11)18-12/h21H,1-10H2,(H2,15,17,18,20) |
| InChIKey | CQIBMMWIOHOKBM-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |