C13H16N2 — CID 12864595
11-methyl-2,3,4,5-tetrahydro-1H-[1,4]diazepino[1,2-a]indole (PubChem CID 12864595) has the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 11-methyl-2,3,4,5-tetrahydro-1H-[1,4]diazepino[1,2-a]indole.
| Compound Name | 11-methyl-2,3,4,5-tetrahydro-1H-[1,4]diazepino[1,2-a]indole |
|---|---|
| PubChem CID | 12864595 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 11-methyl-2,3,4,5-tetrahydro-1H-[1,4]diazepino[1,2-a]indole |
| SMILES | Cc1c2n(c3ccccc13)CCCNC2 |
| InChI | InChI=1S/C13H16N2/c1-10-11-5-2-3-6-12(11)15-8-4-7-14-9-13(10)15/h2-3,5-6,14H,4,7-9H2,1H3 |
| InChIKey | WTCOVCCZYYWPOP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|