C7H10N2O3 — CID 12864692
1-ethyl-3-methyl-1,3-diazinane-2,4,6-trione (PubChem CID 12864692) has the molecular formula C7H10N2O3 and a molecular weight of 170.17 g/mol. Its IUPAC name is 1-ethyl-3-methyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-ethyl-3-methyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 12864692 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 1-ethyl-3-methyl-1,3-diazinane-2,4,6-trione |
| SMILES | CCN1C(=O)CC(=O)N(C)C1=O |
| InChI | InChI=1S/C7H10N2O3/c1-3-9-6(11)4-5(10)8(2)7(9)12/h3-4H2,1-2H3 |
| InChIKey | AHCIDIIPDVSEQX-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|