About 1-benzofuran-3-yl-(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)methanone
1-benzofuran-3-yl-(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)methanone (PubChem CID 128647120) has the molecular formula C17H19NO4S
and a molecular weight of 333.41 g/mol. Its IUPAC name is 1-benzofuran-3-yl-(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)methanone.
Molecular Properties
| Compound Name | 1-benzofuran-3-yl-(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)methanone |
| PubChem CID | 128647120 |
| Molecular Formula | C17H19NO4S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 1-benzofuran-3-yl-(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)methanone |
| SMILES | O=C(c1coc2ccccc12)N1CCCC2(CCS(=O)(=O)C2)C1 |
| InChI | InChI=1S/C17H19NO4S/c19-16(14-10-22-15-5-2-1-4-13(14)15)18-8-3-6-17(11-18)7-9-23(20,21)12-17/h1-2,4-5,10H,3,6-9,11-12H2 |
| InChIKey | HRYRWAWVOFYZPJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-benzofuran-3-yl-(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzofuran-3-yl-(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)methanone?
The IUPAC name of 1-benzofuran-3-yl-(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)methanone (CID 128647120) is 1-benzofuran-3-yl-(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)methanone.
What is the SMILES notation for 1-benzofuran-3-yl-(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)methanone?
The canonical SMILES for 1-benzofuran-3-yl-(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)methanone is O=C(c1coc2ccccc12)N1CCCC2(CCS(=O)(=O)C2)C1.
What is the InChIKey of 1-benzofuran-3-yl-(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)methanone?
The InChIKey is HRYRWAWVOFYZPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19NO4S/c19-16(14-10-22-15-5-2-1-4-13(14)15)18-8-3-6-17(11-18)7-9-23(20,21)12-17/h1-2,4-5,10H,3,6-9,11-12H2.
What are the key properties of 1-benzofuran-3-yl-(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)methanone?
1-benzofuran-3-yl-(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)methanone has a molecular weight of 333.41 g/mol, XLogP of 2.47, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzofuran-3-yl-(2,2-dioxo-2λ6-thia-9-azaspiro[4.5]decan-9-yl)methanone is sourced from PubChem (CID 128647120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).