C13H17N5S — CID 12864842
2-[[4-[(E)-benzylideneamino]-1,2,4-triazol-3-yl]sulfanyl]-N,N-dimethylethanamine (PubChem CID 12864842) has the molecular formula C13H17N5S and a molecular weight of 275.38 g/mol. Its IUPAC name is 2-[[4-[(E)-benzylideneamino]-1,2,4-triazol-3-yl]sulfanyl]-N,N-dimethylethanamine.
| Compound Name | 2-[[4-[(E)-benzylideneamino]-1,2,4-triazol-3-yl]sulfanyl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 12864842 |
| Molecular Formula | C13H17N5S |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 2-[[4-[(E)-benzylideneamino]-1,2,4-triazol-3-yl]sulfanyl]-N,N-dimethylethanamine |
| SMILES | CN(C)CCSc1nncn1/N=C/c1ccccc1 |
| InChI | InChI=1S/C13H17N5S/c1-17(2)8-9-19-13-16-14-11-18(13)15-10-12-6-4-3-5-7-12/h3-7,10-11H,8-9H2,1-2H3/b15-10+ |
| InChIKey | MHJDDTHATSOJLS-XNTDXEJSSA-N |
| XLogP | 1.81 |
| TPSA | 46.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|