About carbon monoxide;ethyl azepine-1-carboxylate;iron
carbon monoxide;ethyl azepine-1-carboxylate;iron (PubChem CID 12865394) has the molecular formula C12H11FeNO5
and a molecular weight of 305.07 g/mol. Its IUPAC name is carbon monoxide;ethyl azepine-1-carboxylate;iron.
Molecular Properties
| Compound Name | carbon monoxide;ethyl azepine-1-carboxylate;iron |
| PubChem CID | 12865394 |
| Molecular Formula | C12H11FeNO5 |
| Molecular Weight | 305.07 g/mol |
| Exact Mass | 305.00 |
| IUPAC Name | carbon monoxide;ethyl azepine-1-carboxylate;iron |
| SMILES | CCOC(=O)N1C=CC=CC=C1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Fe] |
| InChI | InChI=1S/C9H11NO2.3CO.Fe/c1-2-12-9(11)10-7-5-3-4-6-8-10;3*1-2;/h3-8H,2H2,1H3;;;; |
| InChIKey | SSDOKZJSUOGQOQ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 89.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.07 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze carbon monoxide;ethyl azepine-1-carboxylate;iron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon monoxide;ethyl azepine-1-carboxylate;iron?
The IUPAC name of carbon monoxide;ethyl azepine-1-carboxylate;iron (CID 12865394) is carbon monoxide;ethyl azepine-1-carboxylate;iron.
What is the SMILES notation for carbon monoxide;ethyl azepine-1-carboxylate;iron?
The canonical SMILES for carbon monoxide;ethyl azepine-1-carboxylate;iron is CCOC(=O)N1C=CC=CC=C1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Fe].
What is the InChIKey of carbon monoxide;ethyl azepine-1-carboxylate;iron?
The InChIKey is SSDOKZJSUOGQOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2.3CO.Fe/c1-2-12-9(11)10-7-5-3-4-6-8-10;3*1-2;/h3-8H,2H2,1H3;;;;.
What are the key properties of carbon monoxide;ethyl azepine-1-carboxylate;iron?
carbon monoxide;ethyl azepine-1-carboxylate;iron has a molecular weight of 305.07 g/mol, XLogP of 1.93, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;ethyl azepine-1-carboxylate;iron is sourced from PubChem (CID 12865394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).