About [(3,5-dibromo-2-hydroxyphenyl)methylideneamino]thiourea
[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]thiourea (PubChem CID 1286604) has the molecular formula C8H7Br2N3OS
and a molecular weight of 353.04 g/mol. Its IUPAC name is [(3,5-dibromo-2-hydroxyphenyl)methylideneamino]thiourea.
Molecular Properties
| Compound Name | [(3,5-dibromo-2-hydroxyphenyl)methylideneamino]thiourea |
| PubChem CID | 1286604 |
| Molecular Formula | C8H7Br2N3OS |
| Molecular Weight | 353.04 g/mol |
| Exact Mass | 350.87 |
| IUPAC Name | [(3,5-dibromo-2-hydroxyphenyl)methylideneamino]thiourea |
| SMILES | NC(=S)NN=Cc1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C8H7Br2N3OS/c9-5-1-4(3-12-13-8(11)15)7(14)6(10)2-5/h1-3,14H,(H3,11,13,15) |
| InChIKey | KOUSSFCOFUJIJA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.04 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(3,5-dibromo-2-hydroxyphenyl)methylideneamino]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3,5-dibromo-2-hydroxyphenyl)methylideneamino]thiourea?
The IUPAC name of [(3,5-dibromo-2-hydroxyphenyl)methylideneamino]thiourea (CID 1286604) is [(3,5-dibromo-2-hydroxyphenyl)methylideneamino]thiourea.
What is the SMILES notation for [(3,5-dibromo-2-hydroxyphenyl)methylideneamino]thiourea?
The canonical SMILES for [(3,5-dibromo-2-hydroxyphenyl)methylideneamino]thiourea is NC(=S)NN=Cc1cc(Br)cc(Br)c1O.
What is the InChIKey of [(3,5-dibromo-2-hydroxyphenyl)methylideneamino]thiourea?
The InChIKey is KOUSSFCOFUJIJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7Br2N3OS/c9-5-1-4(3-12-13-8(11)15)7(14)6(10)2-5/h1-3,14H,(H3,11,13,15).
What are the key properties of [(3,5-dibromo-2-hydroxyphenyl)methylideneamino]thiourea?
[(3,5-dibromo-2-hydroxyphenyl)methylideneamino]thiourea has a molecular weight of 353.04 g/mol, XLogP of 2.08, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3,5-dibromo-2-hydroxyphenyl)methylideneamino]thiourea is sourced from PubChem (CID 1286604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).