C16H24N2O4S2 — CID 128664245
N-cycloheptyl-2-(1,3-oxazinane-3-carbonyl)thiophene-3-sulfonamide (PubChem CID 128664245) has the molecular formula C16H24N2O4S2 and a molecular weight of 372.51 g/mol. Its IUPAC name is N-cycloheptyl-2-(1,3-oxazinane-3-carbonyl)thiophene-3-sulfonamide.
| Compound Name | N-cycloheptyl-2-(1,3-oxazinane-3-carbonyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 128664245 |
| Molecular Formula | C16H24N2O4S2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | N-cycloheptyl-2-(1,3-oxazinane-3-carbonyl)thiophene-3-sulfonamide |
| SMILES | O=C(c1sccc1S(=O)(=O)NC1CCCCCC1)N1CCCOC1 |
| InChI | InChI=1S/C16H24N2O4S2/c19-16(18-9-5-10-22-12-18)15-14(8-11-23-15)24(20,21)17-13-6-3-1-2-4-7-13/h8,11,13,17H,1-7,9-10,12H2 |
| InChIKey | YXAQFDMVHIEPHC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |