C16H22F5P — CID 12866565
(2,3,4,5,6-pentafluorophenyl)methylidene-tri(propan-2-yl)-λ5-phosphane (PubChem CID 12866565) has the molecular formula C16H22F5P and a molecular weight of 340.32 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl)methylidene-tri(propan-2-yl)-λ5-phosphane.
| Compound Name | (2,3,4,5,6-pentafluorophenyl)methylidene-tri(propan-2-yl)-λ5-phosphane |
|---|---|
| PubChem CID | 12866565 |
| Molecular Formula | C16H22F5P |
| Molecular Weight | 340.32 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl)methylidene-tri(propan-2-yl)-λ5-phosphane |
| SMILES | CC(C)P(=Cc1c(F)c(F)c(F)c(F)c1F)(C(C)C)C(C)C |
| InChI | InChI=1S/C16H22F5P/c1-8(2)22(9(3)4,10(5)6)7-11-12(17)14(19)16(21)15(20)13(11)18/h7-10H,1-6H3 |
| InChIKey | QZDOUEJZLRXMQH-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.32 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|