C25H16F5P — CID 12866566
(2,3,4,5,6-pentafluorophenyl)methylidene-triphenyl-lambda5-phosphane (PubChem CID 12866566) has the molecular formula C25H16F5P and a molecular weight of 442.37 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl)methylidene-triphenyl-lambda5-phosphane.
| Compound Name | (2,3,4,5,6-pentafluorophenyl)methylidene-triphenyl-lambda5-phosphane |
|---|---|
| PubChem CID | 12866566 |
| Molecular Formula | C25H16F5P |
| Molecular Weight | 442.37 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl)methylidene-triphenyl-lambda5-phosphane |
| SMILES | Fc1c(F)c(F)c(C=P(c2ccccc2)(c2ccccc2)c2ccccc2)c(F)c1F |
| InChI | InChI=1S/C25H16F5P/c26-21-20(22(27)24(29)25(30)23(21)28)16-31(17-10-4-1-5-11-17,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h1-16H |
| InChIKey | MYWXUSIAWBOYOL-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.37 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|