About 2-(2-methylpropyl)-1,3-thiazolidin-4-one
2-(2-methylpropyl)-1,3-thiazolidin-4-one (PubChem CID 12866704) has the molecular formula C7H13NOS
and a molecular weight of 159.25 g/mol. Its IUPAC name is 2-(2-methylpropyl)-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 2-(2-methylpropyl)-1,3-thiazolidin-4-one |
| PubChem CID | 12866704 |
| Molecular Formula | C7H13NOS |
| Molecular Weight | 159.25 g/mol |
| Exact Mass | 159.07 |
| IUPAC Name | 2-(2-methylpropyl)-1,3-thiazolidin-4-one |
| SMILES | CC(C)CC1NC(=O)CS1 |
| InChI | InChI=1S/C7H13NOS/c1-5(2)3-7-8-6(9)4-10-7/h5,7H,3-4H2,1-2H3,(H,8,9) |
| InChIKey | FCPIKVJIINDNBX-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.25 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2-methylpropyl)-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylpropyl)-1,3-thiazolidin-4-one?
The IUPAC name of 2-(2-methylpropyl)-1,3-thiazolidin-4-one (CID 12866704) is 2-(2-methylpropyl)-1,3-thiazolidin-4-one.
What is the SMILES notation for 2-(2-methylpropyl)-1,3-thiazolidin-4-one?
The canonical SMILES for 2-(2-methylpropyl)-1,3-thiazolidin-4-one is CC(C)CC1NC(=O)CS1.
What is the InChIKey of 2-(2-methylpropyl)-1,3-thiazolidin-4-one?
The InChIKey is FCPIKVJIINDNBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NOS/c1-5(2)3-7-8-6(9)4-10-7/h5,7H,3-4H2,1-2H3,(H,8,9).
What are the key properties of 2-(2-methylpropyl)-1,3-thiazolidin-4-one?
2-(2-methylpropyl)-1,3-thiazolidin-4-one has a molecular weight of 159.25 g/mol, XLogP of 1.22, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylpropyl)-1,3-thiazolidin-4-one is sourced from PubChem (CID 12866704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).