C16H20N2O — CID 12868132
3,13-diazapentacyclo[12.3.1.02,10.04,9.010,15]octadeca-4,6,8-trien-18-ol (PubChem CID 12868132) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is 3,13-diazapentacyclo[12.3.1.02,10.04,9.010,15]octadeca-4,6,8-trien-18-ol.
| Compound Name | 3,13-diazapentacyclo[12.3.1.02,10.04,9.010,15]octadeca-4,6,8-trien-18-ol |
|---|---|
| PubChem CID | 12868132 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 3,13-diazapentacyclo[12.3.1.02,10.04,9.010,15]octadeca-4,6,8-trien-18-ol |
| SMILES | OC1C2CCC3C1NCCC31c3ccccc3NC21 |
| InChI | InChI=1S/C16H20N2O/c19-14-9-5-6-11-13(14)17-8-7-16(11)10-3-1-2-4-12(10)18-15(9)16/h1-4,9,11,13-15,17-19H,5-8H2 |
| InChIKey | KIBBOZTVFHQUPY-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |