C16H24N4O — CID 12868398
3-(4-aminopentylamino)-1-ethyl-7-methyl-1,8-naphthyridin-4-one (PubChem CID 12868398) has the molecular formula C16H24N4O and a molecular weight of 288.40 g/mol. Its IUPAC name is 3-(4-aminopentylamino)-1-ethyl-7-methyl-1,8-naphthyridin-4-one.
| Compound Name | 3-(4-aminopentylamino)-1-ethyl-7-methyl-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 12868398 |
| Molecular Formula | C16H24N4O |
| Molecular Weight | 288.40 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | 3-(4-aminopentylamino)-1-ethyl-7-methyl-1,8-naphthyridin-4-one |
| SMILES | CCn1cc(NCCCC(C)N)c(=O)c2ccc(C)nc21 |
| InChI | InChI=1S/C16H24N4O/c1-4-20-10-14(18-9-5-6-11(2)17)15(21)13-8-7-12(3)19-16(13)20/h7-8,10-11,18H,4-6,9,17H2,1-3H3 |
| InChIKey | UQXWZLINGDNYFF-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|