About 2-(4-chlorophenyl)-4H-1,3-thiazol-5-one
2-(4-chlorophenyl)-4H-1,3-thiazol-5-one (PubChem CID 12868618) has the molecular formula C9H6ClNOS
and a molecular weight of 211.67 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4H-1,3-thiazol-5-one.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-4H-1,3-thiazol-5-one |
| PubChem CID | 12868618 |
| Molecular Formula | C9H6ClNOS |
| Molecular Weight | 211.67 g/mol |
| Exact Mass | 210.99 |
| IUPAC Name | 2-(4-chlorophenyl)-4H-1,3-thiazol-5-one |
| SMILES | O=C1CN=C(c2ccc(Cl)cc2)S1 |
| InChI | InChI=1S/C9H6ClNOS/c10-7-3-1-6(2-4-7)9-11-5-8(12)13-9/h1-4H,5H2 |
| InChIKey | SKUZTNQWZAYMNK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.67 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-chlorophenyl)-4H-1,3-thiazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-4H-1,3-thiazol-5-one?
The IUPAC name of 2-(4-chlorophenyl)-4H-1,3-thiazol-5-one (CID 12868618) is 2-(4-chlorophenyl)-4H-1,3-thiazol-5-one.
What is the SMILES notation for 2-(4-chlorophenyl)-4H-1,3-thiazol-5-one?
The canonical SMILES for 2-(4-chlorophenyl)-4H-1,3-thiazol-5-one is O=C1CN=C(c2ccc(Cl)cc2)S1.
What is the InChIKey of 2-(4-chlorophenyl)-4H-1,3-thiazol-5-one?
The InChIKey is SKUZTNQWZAYMNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6ClNOS/c10-7-3-1-6(2-4-7)9-11-5-8(12)13-9/h1-4H,5H2.
What are the key properties of 2-(4-chlorophenyl)-4H-1,3-thiazol-5-one?
2-(4-chlorophenyl)-4H-1,3-thiazol-5-one has a molecular weight of 211.67 g/mol, XLogP of 2.36, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-4H-1,3-thiazol-5-one is sourced from PubChem (CID 12868618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).