About 2,7-dimethoxynaphthalene-1,8-diamine
2,7-dimethoxynaphthalene-1,8-diamine (PubChem CID 12868710) has the molecular formula C12H14N2O2
and a molecular weight of 218.26 g/mol. Its IUPAC name is 2,7-dimethoxynaphthalene-1,8-diamine.
Molecular Properties
| Compound Name | 2,7-dimethoxynaphthalene-1,8-diamine |
| PubChem CID | 12868710 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 2,7-dimethoxynaphthalene-1,8-diamine |
| SMILES | COc1ccc2ccc(OC)c(N)c2c1N |
| InChI | InChI=1S/C12H14N2O2/c1-15-8-5-3-7-4-6-9(16-2)12(14)10(7)11(8)13/h3-6H,13-14H2,1-2H3 |
| InChIKey | RXGBZEPNCUJKKM-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2,7-dimethoxynaphthalene-1,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-dimethoxynaphthalene-1,8-diamine?
The IUPAC name of 2,7-dimethoxynaphthalene-1,8-diamine (CID 12868710) is 2,7-dimethoxynaphthalene-1,8-diamine.
What is the SMILES notation for 2,7-dimethoxynaphthalene-1,8-diamine?
The canonical SMILES for 2,7-dimethoxynaphthalene-1,8-diamine is COc1ccc2ccc(OC)c(N)c2c1N.
What is the InChIKey of 2,7-dimethoxynaphthalene-1,8-diamine?
The InChIKey is RXGBZEPNCUJKKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O2/c1-15-8-5-3-7-4-6-9(16-2)12(14)10(7)11(8)13/h3-6H,13-14H2,1-2H3.
What are the key properties of 2,7-dimethoxynaphthalene-1,8-diamine?
2,7-dimethoxynaphthalene-1,8-diamine has a molecular weight of 218.26 g/mol, XLogP of 2.02, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-dimethoxynaphthalene-1,8-diamine is sourced from PubChem (CID 12868710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).