About ethyl 2-(4-bromophenyl)-5-methyl-1,3-oxazole-4-carboxylate
ethyl 2-(4-bromophenyl)-5-methyl-1,3-oxazole-4-carboxylate (PubChem CID 12868787) has the molecular formula C13H12BrNO3
and a molecular weight of 310.15 g/mol. Its IUPAC name is ethyl 2-(4-bromophenyl)-5-methyl-1,3-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-(4-bromophenyl)-5-methyl-1,3-oxazole-4-carboxylate |
| PubChem CID | 12868787 |
| Molecular Formula | C13H12BrNO3 |
| Molecular Weight | 310.15 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | ethyl 2-(4-bromophenyl)-5-methyl-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(-c2ccc(Br)cc2)oc1C |
| InChI | InChI=1S/C13H12BrNO3/c1-3-17-13(16)11-8(2)18-12(15-11)9-4-6-10(14)7-5-9/h4-7H,3H2,1-2H3 |
| InChIKey | CFBVDJAFDNBQCL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.15 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-(4-bromophenyl)-5-methyl-1,3-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(4-bromophenyl)-5-methyl-1,3-oxazole-4-carboxylate?
The IUPAC name of ethyl 2-(4-bromophenyl)-5-methyl-1,3-oxazole-4-carboxylate (CID 12868787) is ethyl 2-(4-bromophenyl)-5-methyl-1,3-oxazole-4-carboxylate.
What is the SMILES notation for ethyl 2-(4-bromophenyl)-5-methyl-1,3-oxazole-4-carboxylate?
The canonical SMILES for ethyl 2-(4-bromophenyl)-5-methyl-1,3-oxazole-4-carboxylate is CCOC(=O)c1nc(-c2ccc(Br)cc2)oc1C.
What is the InChIKey of ethyl 2-(4-bromophenyl)-5-methyl-1,3-oxazole-4-carboxylate?
The InChIKey is CFBVDJAFDNBQCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12BrNO3/c1-3-17-13(16)11-8(2)18-12(15-11)9-4-6-10(14)7-5-9/h4-7H,3H2,1-2H3.
What are the key properties of ethyl 2-(4-bromophenyl)-5-methyl-1,3-oxazole-4-carboxylate?
ethyl 2-(4-bromophenyl)-5-methyl-1,3-oxazole-4-carboxylate has a molecular weight of 310.15 g/mol, XLogP of 3.59, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(4-bromophenyl)-5-methyl-1,3-oxazole-4-carboxylate is sourced from PubChem (CID 12868787), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).