C20H30N2O3 — CID 128694848
N-[(1R)-1-(2-methoxy-5-methylphenyl)ethyl]-9-oxa-2-azaspiro[5.5]undecane-2-carboxamide (PubChem CID 128694848) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is N-[(1R)-1-(2-methoxy-5-methylphenyl)ethyl]-9-oxa-2-azaspiro[5.5]undecane-2-carboxamide.
| Compound Name | N-[(1R)-1-(2-methoxy-5-methylphenyl)ethyl]-9-oxa-2-azaspiro[5.5]undecane-2-carboxamide |
|---|---|
| PubChem CID | 128694848 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | N-[(1R)-1-(2-methoxy-5-methylphenyl)ethyl]-9-oxa-2-azaspiro[5.5]undecane-2-carboxamide |
| SMILES | COc1ccc(C)cc1[C@@H](C)NC(=O)N1CCCC2(CCOCC2)C1 |
| InChI | InChI=1S/C20H30N2O3/c1-15-5-6-18(24-3)17(13-15)16(2)21-19(23)22-10-4-7-20(14-22)8-11-25-12-9-20/h5-6,13,16H,4,7-12,14H2,1-3H3,(H,21,23)/t16-/m1/s1 |
| InChIKey | RDIUOTKAKRJQFJ-MRXNPFEDSA-N |
| XLogP | 3.67 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |