C35H27F3N2O3S — CID 12869647
1-benzyl-2,3,4,5-tetraphenylimidazol-1-ium;trifluoromethanesulfonate (PubChem CID 12869647) has the molecular formula C35H27F3N2O3S and a molecular weight of 612.67 g/mol. Its IUPAC name is 1-benzyl-2,3,4,5-tetraphenylimidazol-1-ium;trifluoromethanesulfonate.
| Compound Name | 1-benzyl-2,3,4,5-tetraphenylimidazol-1-ium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 12869647 |
| Molecular Formula | C35H27F3N2O3S |
| Molecular Weight | 612.67 g/mol |
| Exact Mass | 612.17 |
| IUPAC Name | 1-benzyl-2,3,4,5-tetraphenylimidazol-1-ium;trifluoromethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)F.c1ccc(C[n+]2c(-c3ccccc3)c(-c3ccccc3)n(-c3ccccc3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C34H27N2.CHF3O3S/c1-6-16-27(17-7-1)26-35-32(28-18-8-2-9-19-28)33(29-20-10-3-11-21-29)36(31-24-14-5-15-25-31)34(35)30-22-12-4-13-23-30;2-1(3,4)8(5,6)7/h1-25H,26H2;(H,5,6,7)/q+1;/p-1 |
| InChIKey | ROMJUKTZXHQCBZ-UHFFFAOYSA-M |
| XLogP | 7.87 |
| TPSA | 66.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.67 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|