About 1-[(4,4-difluorocyclohexyl)methyl]piperidin-4-ol
1-[(4,4-difluorocyclohexyl)methyl]piperidin-4-ol (PubChem CID 128699600) has the molecular formula C12H21F2NO
and a molecular weight of 233.30 g/mol. Its IUPAC name is 1-[(4,4-difluorocyclohexyl)methyl]piperidin-4-ol.
Molecular Properties
| Compound Name | 1-[(4,4-difluorocyclohexyl)methyl]piperidin-4-ol |
| PubChem CID | 128699600 |
| Molecular Formula | C12H21F2NO |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 1-[(4,4-difluorocyclohexyl)methyl]piperidin-4-ol |
| SMILES | OC1CCN(CC2CCC(F)(F)CC2)CC1 |
| InChI | InChI=1S/C12H21F2NO/c13-12(14)5-1-10(2-6-12)9-15-7-3-11(16)4-8-15/h10-11,16H,1-9H2 |
| InChIKey | DTFRAOIUIGQPQT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(4,4-difluorocyclohexyl)methyl]piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4,4-difluorocyclohexyl)methyl]piperidin-4-ol?
The IUPAC name of 1-[(4,4-difluorocyclohexyl)methyl]piperidin-4-ol (CID 128699600) is 1-[(4,4-difluorocyclohexyl)methyl]piperidin-4-ol.
What is the SMILES notation for 1-[(4,4-difluorocyclohexyl)methyl]piperidin-4-ol?
The canonical SMILES for 1-[(4,4-difluorocyclohexyl)methyl]piperidin-4-ol is OC1CCN(CC2CCC(F)(F)CC2)CC1.
What is the InChIKey of 1-[(4,4-difluorocyclohexyl)methyl]piperidin-4-ol?
The InChIKey is DTFRAOIUIGQPQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21F2NO/c13-12(14)5-1-10(2-6-12)9-15-7-3-11(16)4-8-15/h10-11,16H,1-9H2.
What are the key properties of 1-[(4,4-difluorocyclohexyl)methyl]piperidin-4-ol?
1-[(4,4-difluorocyclohexyl)methyl]piperidin-4-ol has a molecular weight of 233.30 g/mol, XLogP of 2.27, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4,4-difluorocyclohexyl)methyl]piperidin-4-ol is sourced from PubChem (CID 128699600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).