C14H21N3O6 — CID 12870301
ethyl 2-[(4aS,7aR)-4-(2-ethoxy-2-oxoethyl)-5,7-dioxo-2,3,4a,7a-tetrahydropyrrolo[3,4-b]pyrazin-1-yl]acetate (PubChem CID 12870301) has the molecular formula C14H21N3O6 and a molecular weight of 327.34 g/mol. Its IUPAC name is ethyl 2-[(4aS,7aR)-4-(2-ethoxy-2-oxoethyl)-5,7-dioxo-2,3,4a,7a-tetrahydropyrrolo[3,4-b]pyrazin-1-yl]acetate.
| Compound Name | ethyl 2-[(4aS,7aR)-4-(2-ethoxy-2-oxoethyl)-5,7-dioxo-2,3,4a,7a-tetrahydropyrrolo[3,4-b]pyrazin-1-yl]acetate |
|---|---|
| PubChem CID | 12870301 |
| Molecular Formula | C14H21N3O6 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | ethyl 2-[(4aS,7aR)-4-(2-ethoxy-2-oxoethyl)-5,7-dioxo-2,3,4a,7a-tetrahydropyrrolo[3,4-b]pyrazin-1-yl]acetate |
| SMILES | CCOC(=O)CN1CCN(CC(=O)OCC)[C@H]2C(=O)NC(=O)[C@H]21 |
| InChI | InChI=1S/C14H21N3O6/c1-3-22-9(18)7-16-5-6-17(8-10(19)23-4-2)12-11(16)13(20)15-14(12)21/h11-12H,3-8H2,1-2H3,(H,15,20,21)/t11-,12+ |
| InChIKey | ABHDRJKIMOWLSD-TXEJJXNPSA-N |
| XLogP | -1.88 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|