C16H21N3O3S2 — CID 128704486
1-[[5-(1-methylpyrazol-4-yl)thiophen-2-yl]methyl]-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazine 4,4-dioxide (PubChem CID 128704486) has the molecular formula C16H21N3O3S2 and a molecular weight of 367.50 g/mol. Its IUPAC name is 1-[[5-(1-methylpyrazol-4-yl)thiophen-2-yl]methyl]-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazine 4,4-dioxide.
| Compound Name | 1-[[5-(1-methylpyrazol-4-yl)thiophen-2-yl]methyl]-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazine 4,4-dioxide |
|---|---|
| PubChem CID | 128704486 |
| Molecular Formula | C16H21N3O3S2 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 1-[[5-(1-methylpyrazol-4-yl)thiophen-2-yl]methyl]-3,4a,5,7,8,8a-hexahydro-2H-pyrano[3,4-b][1,4]thiazine 4,4-dioxide |
| SMILES | Cn1cc(-c2ccc(CN3CCS(=O)(=O)C4COCCC43)s2)cn1 |
| InChI | InChI=1S/C16H21N3O3S2/c1-18-9-12(8-17-18)15-3-2-13(23-15)10-19-5-7-24(20,21)16-11-22-6-4-14(16)19/h2-3,8-9,14,16H,4-7,10-11H2,1H3 |
| InChIKey | QKTIENWGEVKODM-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |