About (E)-8-imidazol-1-yl-4,4-dimethyloct-2-enoic acid
(E)-8-imidazol-1-yl-4,4-dimethyloct-2-enoic acid (PubChem CID 12870486) has the molecular formula C13H20N2O2
and a molecular weight of 236.31 g/mol. Its IUPAC name is (E)-8-imidazol-1-yl-4,4-dimethyloct-2-enoic acid.
Molecular Properties
| Compound Name | (E)-8-imidazol-1-yl-4,4-dimethyloct-2-enoic acid |
| PubChem CID | 12870486 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | (E)-8-imidazol-1-yl-4,4-dimethyloct-2-enoic acid |
| SMILES | CC(C)(/C=C/C(=O)O)CCCCn1ccnc1 |
| InChI | InChI=1S/C13H20N2O2/c1-13(2,7-5-12(16)17)6-3-4-9-15-10-8-14-11-15/h5,7-8,10-11H,3-4,6,9H2,1-2H3,(H,16,17)/b7-5+ |
| InChIKey | IHIJCYKHHWZJTB-FNORWQNLSA-N |
| XLogP | 2.72 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-8-imidazol-1-yl-4,4-dimethyloct-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-8-imidazol-1-yl-4,4-dimethyloct-2-enoic acid?
The IUPAC name of (E)-8-imidazol-1-yl-4,4-dimethyloct-2-enoic acid (CID 12870486) is (E)-8-imidazol-1-yl-4,4-dimethyloct-2-enoic acid.
What is the SMILES notation for (E)-8-imidazol-1-yl-4,4-dimethyloct-2-enoic acid?
The canonical SMILES for (E)-8-imidazol-1-yl-4,4-dimethyloct-2-enoic acid is CC(C)(/C=C/C(=O)O)CCCCn1ccnc1.
What is the InChIKey of (E)-8-imidazol-1-yl-4,4-dimethyloct-2-enoic acid?
The InChIKey is IHIJCYKHHWZJTB-FNORWQNLSA-N. The full InChI is InChI=1S/C13H20N2O2/c1-13(2,7-5-12(16)17)6-3-4-9-15-10-8-14-11-15/h5,7-8,10-11H,3-4,6,9H2,1-2H3,(H,16,17)/b7-5+.
What are the key properties of (E)-8-imidazol-1-yl-4,4-dimethyloct-2-enoic acid?
(E)-8-imidazol-1-yl-4,4-dimethyloct-2-enoic acid has a molecular weight of 236.31 g/mol, XLogP of 2.72, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-8-imidazol-1-yl-4,4-dimethyloct-2-enoic acid is sourced from PubChem (CID 12870486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).