About (E)-8-imidazol-1-yl-4,4-dimethyloct-2-enoic acid;hydrochloride
(E)-8-imidazol-1-yl-4,4-dimethyloct-2-enoic acid;hydrochloride (PubChem CID 12870487) has the molecular formula C13H21ClN2O2
and a molecular weight of 272.78 g/mol. Its IUPAC name is (E)-8-imidazol-1-yl-4,4-dimethyloct-2-enoic acid;hydrochloride.
Molecular Properties
| Compound Name | (E)-8-imidazol-1-yl-4,4-dimethyloct-2-enoic acid;hydrochloride |
| PubChem CID | 12870487 |
| Molecular Formula | C13H21ClN2O2 |
| Molecular Weight | 272.78 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | (E)-8-imidazol-1-yl-4,4-dimethyloct-2-enoic acid;hydrochloride |
| SMILES | CC(C)(/C=C/C(=O)O)CCCCn1ccnc1.Cl |
| InChI | InChI=1S/C13H20N2O2.ClH/c1-13(2,7-5-12(16)17)6-3-4-9-15-10-8-14-11-15;/h5,7-8,10-11H,3-4,6,9H2,1-2H3,(H,16,17);1H/b7-5+; |
| InChIKey | LAZFIINNDOJNHQ-GZOLSCHFSA-N |
| XLogP | 3.14 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.78 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-8-imidazol-1-yl-4,4-dimethyloct-2-enoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-8-imidazol-1-yl-4,4-dimethyloct-2-enoic acid;hydrochloride?
The IUPAC name of (E)-8-imidazol-1-yl-4,4-dimethyloct-2-enoic acid;hydrochloride (CID 12870487) is (E)-8-imidazol-1-yl-4,4-dimethyloct-2-enoic acid;hydrochloride.
What is the SMILES notation for (E)-8-imidazol-1-yl-4,4-dimethyloct-2-enoic acid;hydrochloride?
The canonical SMILES for (E)-8-imidazol-1-yl-4,4-dimethyloct-2-enoic acid;hydrochloride is CC(C)(/C=C/C(=O)O)CCCCn1ccnc1.Cl.
What is the InChIKey of (E)-8-imidazol-1-yl-4,4-dimethyloct-2-enoic acid;hydrochloride?
The InChIKey is LAZFIINNDOJNHQ-GZOLSCHFSA-N. The full InChI is InChI=1S/C13H20N2O2.ClH/c1-13(2,7-5-12(16)17)6-3-4-9-15-10-8-14-11-15;/h5,7-8,10-11H,3-4,6,9H2,1-2H3,(H,16,17);1H/b7-5+;.
What are the key properties of (E)-8-imidazol-1-yl-4,4-dimethyloct-2-enoic acid;hydrochloride?
(E)-8-imidazol-1-yl-4,4-dimethyloct-2-enoic acid;hydrochloride has a molecular weight of 272.78 g/mol, XLogP of 3.14, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-8-imidazol-1-yl-4,4-dimethyloct-2-enoic acid;hydrochloride is sourced from PubChem (CID 12870487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).