C19H22N2O4 — CID 128712940
(2R)-N-(2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl)-2-(1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 128712940) has the molecular formula C19H22N2O4 and a molecular weight of 342.39 g/mol. Its IUPAC name is (2R)-N-(2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl)-2-(1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | (2R)-N-(2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl)-2-(1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 128712940 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | (2R)-N-(2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl)-2-(1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | C[C@H](C(=O)NC1CCCC2OCCC12)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H22N2O4/c1-11(21-18(23)12-5-2-3-6-13(12)19(21)24)17(22)20-15-7-4-8-16-14(15)9-10-25-16/h2-3,5-6,11,14-16H,4,7-10H2,1H3,(H,20,22)/t11-,14?,15?,16?/m1/s1 |
| InChIKey | TYCNDXIAXFCQHI-RWNOOTDVSA-N |
| XLogP | 1.74 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|