C10H5F5N2O2 — CID 12871985
6-(1,1,2,2,2-pentafluoroethyl)-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 12871985) has the molecular formula C10H5F5N2O2 and a molecular weight of 280.15 g/mol. Its IUPAC name is 6-(1,1,2,2,2-pentafluoroethyl)-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 6-(1,1,2,2,2-pentafluoroethyl)-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 12871985 |
| Molecular Formula | C10H5F5N2O2 |
| Molecular Weight | 280.15 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 6-(1,1,2,2,2-pentafluoroethyl)-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | O=c1[nH]c2ccc(C(F)(F)C(F)(F)F)cc2[nH]c1=O |
| InChI | InChI=1S/C10H5F5N2O2/c11-9(12,10(13,14)15)4-1-2-5-6(3-4)17-8(19)7(18)16-5/h1-3H,(H,16,18)(H,17,19) |
| InChIKey | RGQBRYCBKUHOSN-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.15 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|