C12H6F13IO4S — CID 12871987
[phenyl(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-lambda3-iodanyl] hydrogen sulfate (PubChem CID 12871987) has the molecular formula C12H6F13IO4S and a molecular weight of 620.12 g/mol. Its IUPAC name is [phenyl(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-lambda3-iodanyl] hydrogen sulfate.
| Compound Name | [phenyl(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-lambda3-iodanyl] hydrogen sulfate |
|---|---|
| PubChem CID | 12871987 |
| Molecular Formula | C12H6F13IO4S |
| Molecular Weight | 620.12 g/mol |
| Exact Mass | 619.88 |
| IUPAC Name | [phenyl(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)-lambda3-iodanyl] hydrogen sulfate |
| SMILES | O=S(=O)(O)OI(c1ccccc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H6F13IO4S/c13-7(14,9(17,18)11(21,22)23)8(15,16)10(19,20)12(24,25)26(30-31(27,28)29)6-4-2-1-3-5-6/h1-5H,(H,27,28,29) |
| InChIKey | ZHGDNHGRYXGUSD-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.12 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|