C22H22ClN3O2 — CID 128721783
[3-(4-chlorophenyl)benzimidazol-5-yl]-(5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)methanone (PubChem CID 128721783) has the molecular formula C22H22ClN3O2 and a molecular weight of 395.89 g/mol. Its IUPAC name is [3-(4-chlorophenyl)benzimidazol-5-yl]-(5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)methanone.
| Compound Name | [3-(4-chlorophenyl)benzimidazol-5-yl]-(5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)methanone |
|---|---|
| PubChem CID | 128721783 |
| Molecular Formula | C22H22ClN3O2 |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | [3-(4-chlorophenyl)benzimidazol-5-yl]-(5-hydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl)methanone |
| SMILES | O=C(c1ccc2ncn(-c3ccc(Cl)cc3)c2c1)N1CC2CCC(O)CC2C1 |
| InChI | InChI=1S/C22H22ClN3O2/c23-17-3-5-18(6-4-17)26-13-24-20-8-2-14(10-21(20)26)22(28)25-11-15-1-7-19(27)9-16(15)12-25/h2-6,8,10,13,15-16,19,27H,1,7,9,11-12H2 |
| InChIKey | QZAHKNONOAIORF-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |