ethyl pyrazolo[1,5-a]pyridine-2-carboxylate

C10H10N2O2 — CID 12872302

IUPACethyl pyrazolo[1,5-a]pyridine-2-carboxylate
SMILESCCOC(=O)c1cc2ccccn2n1
InChIInChI=1S/C10H10N2O2/c1-2-14-10(13)9-7-8-5-3-4-6-12(8)11-9/h3-7H,2H2,1H3
InChIKeyRVUORKIVEWOASG-UHFFFAOYSA-N
MW190.20 g/mol
LogP1.51
Rot. Bonds2

About ethyl pyrazolo[1,5-a]pyridine-2-carboxylate

ethyl pyrazolo[1,5-a]pyridine-2-carboxylate (PubChem CID 12872302) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is ethyl pyrazolo[1,5-a]pyridine-2-carboxylate.

Molecular Properties

Compound Nameethyl pyrazolo[1,5-a]pyridine-2-carboxylate
PubChem CID12872302
Molecular FormulaC10H10N2O2
Molecular Weight190.20 g/mol
Exact Mass190.07
IUPAC Nameethyl pyrazolo[1,5-a]pyridine-2-carboxylate
SMILESCCOC(=O)c1cc2ccccn2n1
InChIInChI=1S/C10H10N2O2/c1-2-14-10(13)9-7-8-5-3-4-6-12(8)11-9/h3-7H,2H2,1H3
InChIKeyRVUORKIVEWOASG-UHFFFAOYSA-N
XLogP1.51
TPSA43.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500190.20
LogP ≤ 51.51
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze ethyl pyrazolo[1,5-a]pyridine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl pyrazolo[1,5-a]pyridine-2-carboxylate?
The IUPAC name of ethyl pyrazolo[1,5-a]pyridine-2-carboxylate (CID 12872302) is ethyl pyrazolo[1,5-a]pyridine-2-carboxylate.
What is the SMILES notation for ethyl pyrazolo[1,5-a]pyridine-2-carboxylate?
The canonical SMILES for ethyl pyrazolo[1,5-a]pyridine-2-carboxylate is CCOC(=O)c1cc2ccccn2n1.
What is the InChIKey of ethyl pyrazolo[1,5-a]pyridine-2-carboxylate?
The InChIKey is RVUORKIVEWOASG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2/c1-2-14-10(13)9-7-8-5-3-4-6-12(8)11-9/h3-7H,2H2,1H3.
What are the key properties of ethyl pyrazolo[1,5-a]pyridine-2-carboxylate?
ethyl pyrazolo[1,5-a]pyridine-2-carboxylate has a molecular weight of 190.20 g/mol, XLogP of 1.51, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl pyrazolo[1,5-a]pyridine-2-carboxylate is sourced from PubChem (CID 12872302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).