About 8,8-dimethyl-1,4-dioxa-8-azoniaspiro[4.5]decane
8,8-dimethyl-1,4-dioxa-8-azoniaspiro[4.5]decane (PubChem CID 12872419) has the molecular formula C9H18NO2+
and a molecular weight of 172.25 g/mol. Its IUPAC name is 8,8-dimethyl-1,4-dioxa-8-azoniaspiro[4.5]decane.
Molecular Properties
| Compound Name | 8,8-dimethyl-1,4-dioxa-8-azoniaspiro[4.5]decane |
| PubChem CID | 12872419 |
| Molecular Formula | C9H18NO2+ |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | 8,8-dimethyl-1,4-dioxa-8-azoniaspiro[4.5]decane |
| SMILES | C[N+]1(C)CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C9H18NO2/c1-10(2)5-3-9(4-6-10)11-7-8-12-9/h3-8H2,1-2H3/q+1 |
| InChIKey | BSSIUQBCZHNSSK-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 8,8-dimethyl-1,4-dioxa-8-azoniaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,8-dimethyl-1,4-dioxa-8-azoniaspiro[4.5]decane?
The IUPAC name of 8,8-dimethyl-1,4-dioxa-8-azoniaspiro[4.5]decane (CID 12872419) is 8,8-dimethyl-1,4-dioxa-8-azoniaspiro[4.5]decane.
What is the SMILES notation for 8,8-dimethyl-1,4-dioxa-8-azoniaspiro[4.5]decane?
The canonical SMILES for 8,8-dimethyl-1,4-dioxa-8-azoniaspiro[4.5]decane is C[N+]1(C)CCC2(CC1)OCCO2.
What is the InChIKey of 8,8-dimethyl-1,4-dioxa-8-azoniaspiro[4.5]decane?
The InChIKey is BSSIUQBCZHNSSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18NO2/c1-10(2)5-3-9(4-6-10)11-7-8-12-9/h3-8H2,1-2H3/q+1.
What are the key properties of 8,8-dimethyl-1,4-dioxa-8-azoniaspiro[4.5]decane?
8,8-dimethyl-1,4-dioxa-8-azoniaspiro[4.5]decane has a molecular weight of 172.25 g/mol, XLogP of 0.60, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8,8-dimethyl-1,4-dioxa-8-azoniaspiro[4.5]decane is sourced from PubChem (CID 12872419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).