C13H17NO — CID 12872558
2-(3,4-dimethylphenyl)-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 12872558) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-(3,4-dimethylphenyl)-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 12872558 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 2-(3,4-dimethylphenyl)-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | Cc1ccc(C2=NC(C)(C)CO2)cc1C |
| InChI | InChI=1S/C13H17NO/c1-9-5-6-11(7-10(9)2)12-14-13(3,4)8-15-12/h5-7H,8H2,1-4H3 |
| InChIKey | PHFRAVFZFOYXBM-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |