C17H28N4O2 — CID 128737521
N-[4-(methoxymethyl)cyclohexyl]-3-(4-methylpyrazol-1-yl)pyrrolidine-1-carboxamide (PubChem CID 128737521) has the molecular formula C17H28N4O2 and a molecular weight of 320.44 g/mol. Its IUPAC name is N-[4-(methoxymethyl)cyclohexyl]-3-(4-methylpyrazol-1-yl)pyrrolidine-1-carboxamide.
| Compound Name | N-[4-(methoxymethyl)cyclohexyl]-3-(4-methylpyrazol-1-yl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 128737521 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | N-[4-(methoxymethyl)cyclohexyl]-3-(4-methylpyrazol-1-yl)pyrrolidine-1-carboxamide |
| SMILES | COCC1CCC(NC(=O)N2CCC(n3cc(C)cn3)C2)CC1 |
| InChI | InChI=1S/C17H28N4O2/c1-13-9-18-21(10-13)16-7-8-20(11-16)17(22)19-15-5-3-14(4-6-15)12-23-2/h9-10,14-16H,3-8,11-12H2,1-2H3,(H,19,22) |
| InChIKey | ITMDNFKTKADTPI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |