About 5-chloro-6-ethylsulfanylpyrazine-2,3-dicarbonitrile
5-chloro-6-ethylsulfanylpyrazine-2,3-dicarbonitrile (PubChem CID 12873754) has the molecular formula C8H5ClN4S
and a molecular weight of 224.68 g/mol. Its IUPAC name is 5-chloro-6-ethylsulfanylpyrazine-2,3-dicarbonitrile.
Molecular Properties
| Compound Name | 5-chloro-6-ethylsulfanylpyrazine-2,3-dicarbonitrile |
| PubChem CID | 12873754 |
| Molecular Formula | C8H5ClN4S |
| Molecular Weight | 224.68 g/mol |
| Exact Mass | 223.99 |
| IUPAC Name | 5-chloro-6-ethylsulfanylpyrazine-2,3-dicarbonitrile |
| SMILES | CCSc1nc(C#N)c(C#N)nc1Cl |
| InChI | InChI=1S/C8H5ClN4S/c1-2-14-8-7(9)12-5(3-10)6(4-11)13-8/h2H2,1H3 |
| InChIKey | LLBCOANRROTHEW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 73.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.68 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-chloro-6-ethylsulfanylpyrazine-2,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-6-ethylsulfanylpyrazine-2,3-dicarbonitrile?
The IUPAC name of 5-chloro-6-ethylsulfanylpyrazine-2,3-dicarbonitrile (CID 12873754) is 5-chloro-6-ethylsulfanylpyrazine-2,3-dicarbonitrile.
What is the SMILES notation for 5-chloro-6-ethylsulfanylpyrazine-2,3-dicarbonitrile?
The canonical SMILES for 5-chloro-6-ethylsulfanylpyrazine-2,3-dicarbonitrile is CCSc1nc(C#N)c(C#N)nc1Cl.
What is the InChIKey of 5-chloro-6-ethylsulfanylpyrazine-2,3-dicarbonitrile?
The InChIKey is LLBCOANRROTHEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5ClN4S/c1-2-14-8-7(9)12-5(3-10)6(4-11)13-8/h2H2,1H3.
What are the key properties of 5-chloro-6-ethylsulfanylpyrazine-2,3-dicarbonitrile?
5-chloro-6-ethylsulfanylpyrazine-2,3-dicarbonitrile has a molecular weight of 224.68 g/mol, XLogP of 1.99, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-6-ethylsulfanylpyrazine-2,3-dicarbonitrile is sourced from PubChem (CID 12873754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).