About 2-ethyl-1,3-dioxo-N-[4-(trifluoromethoxy)phenyl]isoindole-5-carboxamide
2-ethyl-1,3-dioxo-N-[4-(trifluoromethoxy)phenyl]isoindole-5-carboxamide (PubChem CID 1287405) has the molecular formula C18H13F3N2O4
and a molecular weight of 378.31 g/mol. Its IUPAC name is 2-ethyl-1,3-dioxo-N-[4-(trifluoromethoxy)phenyl]isoindole-5-carboxamide.
Molecular Properties
| Compound Name | 2-ethyl-1,3-dioxo-N-[4-(trifluoromethoxy)phenyl]isoindole-5-carboxamide |
| PubChem CID | 1287405 |
| Molecular Formula | C18H13F3N2O4 |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 2-ethyl-1,3-dioxo-N-[4-(trifluoromethoxy)phenyl]isoindole-5-carboxamide |
| SMILES | CCN1C(=O)c2ccc(C(=O)Nc3ccc(OC(F)(F)F)cc3)cc2C1=O |
| InChI | InChI=1S/C18H13F3N2O4/c1-2-23-16(25)13-8-3-10(9-14(13)17(23)26)15(24)22-11-4-6-12(7-5-11)27-18(19,20)21/h3-9H,2H2,1H3,(H,22,24) |
| InChIKey | DOJPGFIEQVQYTN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-1,3-dioxo-N-[4-(trifluoromethoxy)phenyl]isoindole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1,3-dioxo-N-[4-(trifluoromethoxy)phenyl]isoindole-5-carboxamide?
The IUPAC name of 2-ethyl-1,3-dioxo-N-[4-(trifluoromethoxy)phenyl]isoindole-5-carboxamide (CID 1287405) is 2-ethyl-1,3-dioxo-N-[4-(trifluoromethoxy)phenyl]isoindole-5-carboxamide.
What is the SMILES notation for 2-ethyl-1,3-dioxo-N-[4-(trifluoromethoxy)phenyl]isoindole-5-carboxamide?
The canonical SMILES for 2-ethyl-1,3-dioxo-N-[4-(trifluoromethoxy)phenyl]isoindole-5-carboxamide is CCN1C(=O)c2ccc(C(=O)Nc3ccc(OC(F)(F)F)cc3)cc2C1=O.
What is the InChIKey of 2-ethyl-1,3-dioxo-N-[4-(trifluoromethoxy)phenyl]isoindole-5-carboxamide?
The InChIKey is DOJPGFIEQVQYTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13F3N2O4/c1-2-23-16(25)13-8-3-10(9-14(13)17(23)26)15(24)22-11-4-6-12(7-5-11)27-18(19,20)21/h3-9H,2H2,1H3,(H,22,24).
What are the key properties of 2-ethyl-1,3-dioxo-N-[4-(trifluoromethoxy)phenyl]isoindole-5-carboxamide?
2-ethyl-1,3-dioxo-N-[4-(trifluoromethoxy)phenyl]isoindole-5-carboxamide has a molecular weight of 378.31 g/mol, XLogP of 3.45, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1,3-dioxo-N-[4-(trifluoromethoxy)phenyl]isoindole-5-carboxamide is sourced from PubChem (CID 1287405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).