About 2-bromo-5H-thieno[3,2-c]pyridin-4-one
2-bromo-5H-thieno[3,2-c]pyridin-4-one (PubChem CID 12875893) has the molecular formula C7H4BrNOS
and a molecular weight of 230.09 g/mol. Its IUPAC name is 2-bromo-5H-thieno[3,2-c]pyridin-4-one.
Molecular Properties
| Compound Name | 2-bromo-5H-thieno[3,2-c]pyridin-4-one |
| PubChem CID | 12875893 |
| Molecular Formula | C7H4BrNOS |
| Molecular Weight | 230.09 g/mol |
| Exact Mass | 228.92 |
| IUPAC Name | 2-bromo-5H-thieno[3,2-c]pyridin-4-one |
| SMILES | O=c1[nH]ccc2sc(Br)cc12 |
| InChI | InChI=1S/C7H4BrNOS/c8-6-3-4-5(11-6)1-2-9-7(4)10/h1-3H,(H,9,10) |
| InChIKey | ZDUWCUXIWRAXLF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.09 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-bromo-5H-thieno[3,2-c]pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5H-thieno[3,2-c]pyridin-4-one?
The IUPAC name of 2-bromo-5H-thieno[3,2-c]pyridin-4-one (CID 12875893) is 2-bromo-5H-thieno[3,2-c]pyridin-4-one.
What is the SMILES notation for 2-bromo-5H-thieno[3,2-c]pyridin-4-one?
The canonical SMILES for 2-bromo-5H-thieno[3,2-c]pyridin-4-one is O=c1[nH]ccc2sc(Br)cc12.
What is the InChIKey of 2-bromo-5H-thieno[3,2-c]pyridin-4-one?
The InChIKey is ZDUWCUXIWRAXLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BrNOS/c8-6-3-4-5(11-6)1-2-9-7(4)10/h1-3H,(H,9,10).
What are the key properties of 2-bromo-5H-thieno[3,2-c]pyridin-4-one?
2-bromo-5H-thieno[3,2-c]pyridin-4-one has a molecular weight of 230.09 g/mol, XLogP of 2.35, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5H-thieno[3,2-c]pyridin-4-one is sourced from PubChem (CID 12875893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).