About 2-(5-fluoro-1,2-benzoxazol-3-yl)-N-spiro[4.5]decan-10-ylacetamide
2-(5-fluoro-1,2-benzoxazol-3-yl)-N-spiro[4.5]decan-10-ylacetamide (PubChem CID 128759287) has the molecular formula C19H23FN2O2
and a molecular weight of 330.40 g/mol. Its IUPAC name is 2-(5-fluoro-1,2-benzoxazol-3-yl)-N-spiro[4.5]decan-10-ylacetamide.
Molecular Properties
| Compound Name | 2-(5-fluoro-1,2-benzoxazol-3-yl)-N-spiro[4.5]decan-10-ylacetamide |
| PubChem CID | 128759287 |
| Molecular Formula | C19H23FN2O2 |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 2-(5-fluoro-1,2-benzoxazol-3-yl)-N-spiro[4.5]decan-10-ylacetamide |
| SMILES | O=C(Cc1noc2ccc(F)cc12)NC1CCCCC12CCCC2 |
| InChI | InChI=1S/C19H23FN2O2/c20-13-6-7-16-14(11-13)15(22-24-16)12-18(23)21-17-5-1-2-8-19(17)9-3-4-10-19/h6-7,11,17H,1-5,8-10,12H2,(H,21,23) |
| InChIKey | MPCSMXLFGRSTOD-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(5-fluoro-1,2-benzoxazol-3-yl)-N-spiro[4.5]decan-10-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-fluoro-1,2-benzoxazol-3-yl)-N-spiro[4.5]decan-10-ylacetamide?
The IUPAC name of 2-(5-fluoro-1,2-benzoxazol-3-yl)-N-spiro[4.5]decan-10-ylacetamide (CID 128759287) is 2-(5-fluoro-1,2-benzoxazol-3-yl)-N-spiro[4.5]decan-10-ylacetamide.
What is the SMILES notation for 2-(5-fluoro-1,2-benzoxazol-3-yl)-N-spiro[4.5]decan-10-ylacetamide?
The canonical SMILES for 2-(5-fluoro-1,2-benzoxazol-3-yl)-N-spiro[4.5]decan-10-ylacetamide is O=C(Cc1noc2ccc(F)cc12)NC1CCCCC12CCCC2.
What is the InChIKey of 2-(5-fluoro-1,2-benzoxazol-3-yl)-N-spiro[4.5]decan-10-ylacetamide?
The InChIKey is MPCSMXLFGRSTOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23FN2O2/c20-13-6-7-16-14(11-13)15(22-24-16)12-18(23)21-17-5-1-2-8-19(17)9-3-4-10-19/h6-7,11,17H,1-5,8-10,12H2,(H,21,23).
What are the key properties of 2-(5-fluoro-1,2-benzoxazol-3-yl)-N-spiro[4.5]decan-10-ylacetamide?
2-(5-fluoro-1,2-benzoxazol-3-yl)-N-spiro[4.5]decan-10-ylacetamide has a molecular weight of 330.40 g/mol, XLogP of 4.13, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-fluoro-1,2-benzoxazol-3-yl)-N-spiro[4.5]decan-10-ylacetamide is sourced from PubChem (CID 128759287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).