C13H22N6O — CID 128761693
1-(2,2-dimethylpyrrolidin-3-yl)-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)urea (PubChem CID 128761693) has the molecular formula C13H22N6O and a molecular weight of 278.36 g/mol. Its IUPAC name is 1-(2,2-dimethylpyrrolidin-3-yl)-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)urea.
| Compound Name | 1-(2,2-dimethylpyrrolidin-3-yl)-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)urea |
|---|---|
| PubChem CID | 128761693 |
| Molecular Formula | C13H22N6O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | 1-(2,2-dimethylpyrrolidin-3-yl)-3-(5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-2-yl)urea |
| SMILES | CC1(C)NCCC1NC(=O)Nc1nc2n(n1)CCCC2 |
| InChI | InChI=1S/C13H22N6O/c1-13(2)9(6-7-14-13)15-12(20)17-11-16-10-5-3-4-8-19(10)18-11/h9,14H,3-8H2,1-2H3,(H2,15,17,18,20) |
| InChIKey | SECLYJBCANLUAZ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 83.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |