C21H23N — CID 12876530
1-benzhydrylidene-3,5,6,7,8,8a-hexahydro-2H-indolizine (PubChem CID 12876530) has the molecular formula C21H23N and a molecular weight of 289.42 g/mol. Its IUPAC name is 1-benzhydrylidene-3,5,6,7,8,8a-hexahydro-2H-indolizine.
| Compound Name | 1-benzhydrylidene-3,5,6,7,8,8a-hexahydro-2H-indolizine |
|---|---|
| PubChem CID | 12876530 |
| Molecular Formula | C21H23N |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 1-benzhydrylidene-3,5,6,7,8,8a-hexahydro-2H-indolizine |
| SMILES | c1ccc(C(=C2CCN3CCCCC23)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H23N/c1-3-9-17(10-4-1)21(18-11-5-2-6-12-18)19-14-16-22-15-8-7-13-20(19)22/h1-6,9-12,20H,7-8,13-16H2 |
| InChIKey | PCKMKOIOHPIGSJ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |