C18H19ClN2O2S — CID 128778538
6-[(5-chloro-3-pyridinyl)sulfonyl]-8-phenyl-6-azaspiro[3.4]octane (PubChem CID 128778538) has the molecular formula C18H19ClN2O2S and a molecular weight of 362.88 g/mol. Its IUPAC name is 6-[(5-chloro-3-pyridinyl)sulfonyl]-8-phenyl-6-azaspiro[3.4]octane.
| Compound Name | 6-[(5-chloro-3-pyridinyl)sulfonyl]-8-phenyl-6-azaspiro[3.4]octane |
|---|---|
| PubChem CID | 128778538 |
| Molecular Formula | C18H19ClN2O2S |
| Molecular Weight | 362.88 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | 6-[(5-chloro-3-pyridinyl)sulfonyl]-8-phenyl-6-azaspiro[3.4]octane |
| SMILES | O=S(=O)(c1cncc(Cl)c1)N1CC(c2ccccc2)C2(CCC2)C1 |
| InChI | InChI=1S/C18H19ClN2O2S/c19-15-9-16(11-20-10-15)24(22,23)21-12-17(14-5-2-1-3-6-14)18(13-21)7-4-8-18/h1-3,5-6,9-11,17H,4,7-8,12-13H2 |
| InChIKey | KZXYIHZBMYMIKY-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.88 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |