About 8-chloro-6-(2-fluorophenyl)-2-methyl-4H-[1,3]thiazolo[5,4-d][2]benzazepine
8-chloro-6-(2-fluorophenyl)-2-methyl-4H-[1,3]thiazolo[5,4-d][2]benzazepine (PubChem CID 12878269) has the molecular formula C18H12ClFN2S
and a molecular weight of 342.83 g/mol. Its IUPAC name is 8-chloro-6-(2-fluorophenyl)-2-methyl-4H-[1,3]thiazolo[5,4-d][2]benzazepine.
Molecular Properties
| Compound Name | 8-chloro-6-(2-fluorophenyl)-2-methyl-4H-[1,3]thiazolo[5,4-d][2]benzazepine |
| PubChem CID | 12878269 |
| Molecular Formula | C18H12ClFN2S |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 8-chloro-6-(2-fluorophenyl)-2-methyl-4H-[1,3]thiazolo[5,4-d][2]benzazepine |
| SMILES | Cc1nc2c(s1)CN=C(c1ccccc1F)c1cc(Cl)ccc1-2 |
| InChI | InChI=1S/C18H12ClFN2S/c1-10-22-18-12-7-6-11(19)8-14(12)17(21-9-16(18)23-10)13-4-2-3-5-15(13)20/h2-8H,9H2,1H3 |
| InChIKey | XXWBGEXPZRVOQN-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-chloro-6-(2-fluorophenyl)-2-methyl-4H-[1,3]thiazolo[5,4-d][2]benzazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-6-(2-fluorophenyl)-2-methyl-4H-[1,3]thiazolo[5,4-d][2]benzazepine?
The IUPAC name of 8-chloro-6-(2-fluorophenyl)-2-methyl-4H-[1,3]thiazolo[5,4-d][2]benzazepine (CID 12878269) is 8-chloro-6-(2-fluorophenyl)-2-methyl-4H-[1,3]thiazolo[5,4-d][2]benzazepine.
What is the SMILES notation for 8-chloro-6-(2-fluorophenyl)-2-methyl-4H-[1,3]thiazolo[5,4-d][2]benzazepine?
The canonical SMILES for 8-chloro-6-(2-fluorophenyl)-2-methyl-4H-[1,3]thiazolo[5,4-d][2]benzazepine is Cc1nc2c(s1)CN=C(c1ccccc1F)c1cc(Cl)ccc1-2.
What is the InChIKey of 8-chloro-6-(2-fluorophenyl)-2-methyl-4H-[1,3]thiazolo[5,4-d][2]benzazepine?
The InChIKey is XXWBGEXPZRVOQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12ClFN2S/c1-10-22-18-12-7-6-11(19)8-14(12)17(21-9-16(18)23-10)13-4-2-3-5-15(13)20/h2-8H,9H2,1H3.
What are the key properties of 8-chloro-6-(2-fluorophenyl)-2-methyl-4H-[1,3]thiazolo[5,4-d][2]benzazepine?
8-chloro-6-(2-fluorophenyl)-2-methyl-4H-[1,3]thiazolo[5,4-d][2]benzazepine has a molecular weight of 342.83 g/mol, XLogP of 5.26, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-6-(2-fluorophenyl)-2-methyl-4H-[1,3]thiazolo[5,4-d][2]benzazepine is sourced from PubChem (CID 12878269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).