About diethyl 1-acetyl-4-(2-amino-4-chlorophenyl)-3H-pyrrole-2,2-dicarboxylate
diethyl 1-acetyl-4-(2-amino-4-chlorophenyl)-3H-pyrrole-2,2-dicarboxylate (PubChem CID 12878502) has the molecular formula C18H21ClN2O5
and a molecular weight of 380.83 g/mol. Its IUPAC name is diethyl 1-acetyl-4-(2-amino-4-chlorophenyl)-3H-pyrrole-2,2-dicarboxylate.
Molecular Properties
| Compound Name | diethyl 1-acetyl-4-(2-amino-4-chlorophenyl)-3H-pyrrole-2,2-dicarboxylate |
| PubChem CID | 12878502 |
| Molecular Formula | C18H21ClN2O5 |
| Molecular Weight | 380.83 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | diethyl 1-acetyl-4-(2-amino-4-chlorophenyl)-3H-pyrrole-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC(c2ccc(Cl)cc2N)=CN1C(C)=O |
| InChI | InChI=1S/C18H21ClN2O5/c1-4-25-16(23)18(17(24)26-5-2)9-12(10-21(18)11(3)22)14-7-6-13(19)8-15(14)20/h6-8,10H,4-5,9,20H2,1-3H3 |
| InChIKey | CWSUPJWKWFVPHB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.83 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze diethyl 1-acetyl-4-(2-amino-4-chlorophenyl)-3H-pyrrole-2,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 1-acetyl-4-(2-amino-4-chlorophenyl)-3H-pyrrole-2,2-dicarboxylate?
The IUPAC name of diethyl 1-acetyl-4-(2-amino-4-chlorophenyl)-3H-pyrrole-2,2-dicarboxylate (CID 12878502) is diethyl 1-acetyl-4-(2-amino-4-chlorophenyl)-3H-pyrrole-2,2-dicarboxylate.
What is the SMILES notation for diethyl 1-acetyl-4-(2-amino-4-chlorophenyl)-3H-pyrrole-2,2-dicarboxylate?
The canonical SMILES for diethyl 1-acetyl-4-(2-amino-4-chlorophenyl)-3H-pyrrole-2,2-dicarboxylate is CCOC(=O)C1(C(=O)OCC)CC(c2ccc(Cl)cc2N)=CN1C(C)=O.
What is the InChIKey of diethyl 1-acetyl-4-(2-amino-4-chlorophenyl)-3H-pyrrole-2,2-dicarboxylate?
The InChIKey is CWSUPJWKWFVPHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21ClN2O5/c1-4-25-16(23)18(17(24)26-5-2)9-12(10-21(18)11(3)22)14-7-6-13(19)8-15(14)20/h6-8,10H,4-5,9,20H2,1-3H3.
What are the key properties of diethyl 1-acetyl-4-(2-amino-4-chlorophenyl)-3H-pyrrole-2,2-dicarboxylate?
diethyl 1-acetyl-4-(2-amino-4-chlorophenyl)-3H-pyrrole-2,2-dicarboxylate has a molecular weight of 380.83 g/mol, XLogP of 2.38, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 1-acetyl-4-(2-amino-4-chlorophenyl)-3H-pyrrole-2,2-dicarboxylate is sourced from PubChem (CID 12878502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).