About (3,4-dichlorophenyl) thiohypochlorite
(3,4-dichlorophenyl) thiohypochlorite (PubChem CID 12878540) has the molecular formula C6H3Cl3S
and a molecular weight of 213.52 g/mol. Its IUPAC name is (3,4-dichlorophenyl) thiohypochlorite.
Molecular Properties
| Compound Name | (3,4-dichlorophenyl) thiohypochlorite |
| PubChem CID | 12878540 |
| Molecular Formula | C6H3Cl3S |
| Molecular Weight | 213.52 g/mol |
| Exact Mass | 211.90 |
| IUPAC Name | (3,4-dichlorophenyl) thiohypochlorite |
| SMILES | ClSc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C6H3Cl3S/c7-5-2-1-4(10-9)3-6(5)8/h1-3H |
| InChIKey | AKCQLOHUYOQIAP-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.52 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3,4-dichlorophenyl) thiohypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-dichlorophenyl) thiohypochlorite?
The IUPAC name of (3,4-dichlorophenyl) thiohypochlorite (CID 12878540) is (3,4-dichlorophenyl) thiohypochlorite.
What is the SMILES notation for (3,4-dichlorophenyl) thiohypochlorite?
The canonical SMILES for (3,4-dichlorophenyl) thiohypochlorite is ClSc1ccc(Cl)c(Cl)c1.
What is the InChIKey of (3,4-dichlorophenyl) thiohypochlorite?
The InChIKey is AKCQLOHUYOQIAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3Cl3S/c7-5-2-1-4(10-9)3-6(5)8/h1-3H.
What are the key properties of (3,4-dichlorophenyl) thiohypochlorite?
(3,4-dichlorophenyl) thiohypochlorite has a molecular weight of 213.52 g/mol, XLogP of 4.24, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-dichlorophenyl) thiohypochlorite is sourced from PubChem (CID 12878540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).