C9H13NO4S2 — CID 12878682
(2S,5R,6R)-6-methoxy-3,3-dimethyl-7-oxo-6-sulfanyl-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 12878682) has the molecular formula C9H13NO4S2 and a molecular weight of 263.34 g/mol. Its IUPAC name is (2S,5R,6R)-6-methoxy-3,3-dimethyl-7-oxo-6-sulfanyl-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R,6R)-6-methoxy-3,3-dimethyl-7-oxo-6-sulfanyl-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 12878682 |
| Molecular Formula | C9H13NO4S2 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | (2S,5R,6R)-6-methoxy-3,3-dimethyl-7-oxo-6-sulfanyl-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CO[C@@]1(S)C(=O)N2[C@@H](C(=O)O)C(C)(C)S[C@@H]21 |
| InChI | InChI=1S/C9H13NO4S2/c1-8(2)4(5(11)12)10-6(13)9(15,14-3)7(10)16-8/h4,7,15H,1-3H3,(H,11,12)/t4-,7+,9+/m0/s1 |
| InChIKey | ZJUKMMUHDCVZOM-ZJKWWJTRSA-N |
| XLogP | 0.41 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|